C30H49ClO2 — CID 170107755
2-(chloromethyl)-3-[[(10S,13R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxirane (PubChem CID 170107755) has the molecular formula C30H49ClO2 and a molecular weight of 477.17 g/mol. Its IUPAC name is 2-(chloromethyl)-3-[[(10S,13R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxirane.
| Compound Name | 2-(chloromethyl)-3-[[(10S,13R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxirane |
|---|---|
| PubChem CID | 170107755 |
| Molecular Formula | C30H49ClO2 |
| Molecular Weight | 477.17 g/mol |
| Exact Mass | 476.34 |
| IUPAC Name | 2-(chloromethyl)-3-[[(10S,13R,17S)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-2,3,4,5,6,7,8,9,11,12,14,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl]oxy]oxirane |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1C=CC2C3CCC4CC(OC5OC5CCl)CC[C@]4(C)C3CC[C@@]21C |
| InChI | InChI=1S/C30H49ClO2/c1-19(2)7-6-8-20(3)24-11-12-25-23-10-9-21-17-22(32-28-27(18-31)33-28)13-15-29(21,4)26(23)14-16-30(24,25)5/h11-12,19-28H,6-10,13-18H2,1-5H3/t20-,21?,22?,23?,24-,25?,26?,27?,28?,29+,30-/m1/s1 |
| InChIKey | HUZLXQNZSKLKHP-RUZQEZFWSA-N |
| XLogP | 8.23 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.17 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|