C20H18F3IN2O2P2 — CID 170108091
6-[4-(dimethylamino)-2,3-difluoro-5-iodo-6-phosphanylphenyl]-7-fluoro-2-methyl-2-phosphanyl-4-prop-2-ynyl-1,4-benzoxazin-3-one (PubChem CID 170108091) has the molecular formula C20H18F3IN2O2P2 and a molecular weight of 564.22 g/mol. Its IUPAC name is 6-[4-(dimethylamino)-2,3-difluoro-5-iodo-6-phosphanylphenyl]-7-fluoro-2-methyl-2-phosphanyl-4-prop-2-ynyl-1,4-benzoxazin-3-one.
| Compound Name | 6-[4-(dimethylamino)-2,3-difluoro-5-iodo-6-phosphanylphenyl]-7-fluoro-2-methyl-2-phosphanyl-4-prop-2-ynyl-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 170108091 |
| Molecular Formula | C20H18F3IN2O2P2 |
| Molecular Weight | 564.22 g/mol |
| Exact Mass | 563.98 |
| IUPAC Name | 6-[4-(dimethylamino)-2,3-difluoro-5-iodo-6-phosphanylphenyl]-7-fluoro-2-methyl-2-phosphanyl-4-prop-2-ynyl-1,4-benzoxazin-3-one |
| SMILES | C#CCN1C(=O)C(C)(P)Oc2cc(F)c(-c3c(F)c(F)c(N(C)C)c(I)c3P)cc21 |
| InChI | InChI=1S/C20H18F3IN2O2P2/c1-5-6-26-11-7-9(10(21)8-12(11)28-20(2,30)19(26)27)13-14(22)15(23)17(25(3)4)16(24)18(13)29/h1,7-8H,6,29-30H2,2-4H3 |
| InChIKey | MPCGHLZOKKWXGS-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|