C15H30N2 — CID 170108360
5,5-dimethyl-1-N-[(E)-prop-1-enyl]dec-9-ene-1,9-diamine (PubChem CID 170108360) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 5,5-dimethyl-1-N-[(E)-prop-1-enyl]dec-9-ene-1,9-diamine.
| Compound Name | 5,5-dimethyl-1-N-[(E)-prop-1-enyl]dec-9-ene-1,9-diamine |
|---|---|
| PubChem CID | 170108360 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 5,5-dimethyl-1-N-[(E)-prop-1-enyl]dec-9-ene-1,9-diamine |
| SMILES | C=C(N)CCCC(C)(C)CCCCN/C=C/C |
| InChI | InChI=1S/C15H30N2/c1-5-12-17-13-7-6-10-15(3,4)11-8-9-14(2)16/h5,12,17H,2,6-11,13,16H2,1,3-4H3/b12-5+ |
| InChIKey | YOYXRBIQOKRDEJ-LFYBBSHMSA-N |
| XLogP | 3.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|