C22H24F3IN6O — CID 170108597
3-[3,5-difluoro-6-[[(3R,4R)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]-N-(2-iodo-2-methylpropyl)imidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 170108597) has the molecular formula C22H24F3IN6O and a molecular weight of 572.37 g/mol. Its IUPAC name is 3-[3,5-difluoro-6-[[(3R,4R)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]-N-(2-iodo-2-methylpropyl)imidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | 3-[3,5-difluoro-6-[[(3R,4R)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]-N-(2-iodo-2-methylpropyl)imidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 170108597 |
| Molecular Formula | C22H24F3IN6O |
| Molecular Weight | 572.37 g/mol |
| Exact Mass | 572.10 |
| IUPAC Name | 3-[3,5-difluoro-6-[[(3R,4R)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]-N-(2-iodo-2-methylpropyl)imidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | CC(C)(I)CNC(=O)c1ccn2c(-c3nc(N[C@@H]4CNCC[C@H]4F)c(F)cc3F)cnc2c1 |
| InChI | InChI=1S/C22H24F3IN6O/c1-22(2,26)11-29-21(33)12-4-6-32-17(10-28-18(32)7-12)19-14(24)8-15(25)20(31-19)30-16-9-27-5-3-13(16)23/h4,6-8,10,13,16,27H,3,5,9,11H2,1-2H3,(H,29,33)(H,30,31)/t13-,16-/m1/s1 |
| InChIKey | PECGRRDCAOXRHN-CZUORRHYSA-N |
| XLogP | 3.73 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.37 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|