About 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine
1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine (PubChem CID 170109208) has the molecular formula C11H24N2
and a molecular weight of 184.33 g/mol. Its IUPAC name is 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine |
| PubChem CID | 170109208 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine |
| SMILES | C=C(N(C)C(C)C)N(C)C(C)CC |
| InChI | InChI=1S/C11H24N2/c1-8-10(4)13(7)11(5)12(6)9(2)3/h9-10H,5,8H2,1-4,6-7H3 |
| InChIKey | QWRKUPCLJQBTTK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine?
The IUPAC name of 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine (CID 170109208) is 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine.
What is the SMILES notation for 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine?
The canonical SMILES for 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine is C=C(N(C)C(C)C)N(C)C(C)CC.
What is the InChIKey of 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine?
The InChIKey is QWRKUPCLJQBTTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24N2/c1-8-10(4)13(7)11(5)12(6)9(2)3/h9-10H,5,8H2,1-4,6-7H3.
What are the key properties of 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine?
1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine has a molecular weight of 184.33 g/mol, XLogP of 2.53, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-butan-2-yl-1-N,1-N'-dimethyl-1-N-propan-2-ylethene-1,1-diamine is sourced from PubChem (CID 170109208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).