C10H17NO2 — CID 170110313
7-ethyl-6-methyl-2,3,3a,4,7,7a-hexahydrofuro[2,3-c]pyridin-5-one (PubChem CID 170110313) has the molecular formula C10H17NO2 and a molecular weight of 183.25 g/mol. Its IUPAC name is 7-ethyl-6-methyl-2,3,3a,4,7,7a-hexahydrofuro[2,3-c]pyridin-5-one.
| Compound Name | 7-ethyl-6-methyl-2,3,3a,4,7,7a-hexahydrofuro[2,3-c]pyridin-5-one |
|---|---|
| PubChem CID | 170110313 |
| Molecular Formula | C10H17NO2 |
| Molecular Weight | 183.25 g/mol |
| Exact Mass | 183.13 |
| IUPAC Name | 7-ethyl-6-methyl-2,3,3a,4,7,7a-hexahydrofuro[2,3-c]pyridin-5-one |
| SMILES | CCC1C2OCCC2CC(=O)N1C |
| InChI | InChI=1S/C10H17NO2/c1-3-8-10-7(4-5-13-10)6-9(12)11(8)2/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | RXLFLVXVIWQJPU-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.25 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |