C20H33N3O6 — CID 170110529
(3E,5E)-1-N,3-N,5-N-tris(2-hydroxyethyl)-9-methyldeca-1,3,5-triene-1,3,5-tricarboxamide (PubChem CID 170110529) has the molecular formula C20H33N3O6 and a molecular weight of 411.50 g/mol. Its IUPAC name is (3E,5E)-1-N,3-N,5-N-tris(2-hydroxyethyl)-9-methyldeca-1,3,5-triene-1,3,5-tricarboxamide.
| Compound Name | (3E,5E)-1-N,3-N,5-N-tris(2-hydroxyethyl)-9-methyldeca-1,3,5-triene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 170110529 |
| Molecular Formula | C20H33N3O6 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | (3E,5E)-1-N,3-N,5-N-tris(2-hydroxyethyl)-9-methyldeca-1,3,5-triene-1,3,5-tricarboxamide |
| SMILES | C=C(/C=C(\C=C(/CCC(C)C)C(=O)NCCO)C(=O)NCCO)C(=O)NCCO |
| InChI | InChI=1S/C20H33N3O6/c1-14(2)4-5-16(19(28)22-7-10-25)13-17(20(29)23-8-11-26)12-15(3)18(27)21-6-9-24/h12-14,24-26H,3-11H2,1-2H3,(H,21,27)(H,22,28)(H,23,29)/b16-13+,17-12+ |
| InChIKey | PHXUSOLCDAJKIN-JSHGDNENSA-N |
| XLogP | -0.84 |
| TPSA | 147.99 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|