C10H13NO5 — CID 170110562
methyl (3aR,6aS)-2-acetyl-3-oxo-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxylate (PubChem CID 170110562) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl (3aR,6aS)-2-acetyl-3-oxo-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxylate.
| Compound Name | methyl (3aR,6aS)-2-acetyl-3-oxo-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 170110562 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | methyl (3aR,6aS)-2-acetyl-3-oxo-3a,4,6,6a-tetrahydro-2H-furo[3,4-b]pyrrole-1-carboxylate |
| SMILES | COC(=O)N1C(C(C)=O)C(=O)[C@H]2COC[C@H]21 |
| InChI | InChI=1S/C10H13NO5/c1-5(12)8-9(13)6-3-16-4-7(6)11(8)10(14)15-2/h6-8H,3-4H2,1-2H3/t6-,7+,8?/m0/s1 |
| InChIKey | KUHCCNIVUBRPTF-KJFJCRTCSA-N |
| XLogP | -0.39 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|