About [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate
[(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate (PubChem CID 170110763) has the molecular formula C11H18FNO2
and a molecular weight of 215.27 g/mol. Its IUPAC name is [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate.
Molecular Properties
| Compound Name | [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate |
| PubChem CID | 170110763 |
| Molecular Formula | C11H18FNO2 |
| Molecular Weight | 215.27 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate |
| SMILES | C[C@H]1CC[C@@H](OC(=O)NC2(C)CC2)[C@@H]1F |
| InChI | InChI=1S/C11H18FNO2/c1-7-3-4-8(9(7)12)15-10(14)13-11(2)5-6-11/h7-9H,3-6H2,1-2H3,(H,13,14)/t7-,8+,9+/m0/s1 |
| InChIKey | JHSUPVDLRFECEU-DJLDLDEBSA-N |
| XLogP | 2.40 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate?
The IUPAC name of [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate (CID 170110763) is [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate.
What is the SMILES notation for [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate?
The canonical SMILES for [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate is C[C@H]1CC[C@@H](OC(=O)NC2(C)CC2)[C@@H]1F.
What is the InChIKey of [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate?
The InChIKey is JHSUPVDLRFECEU-DJLDLDEBSA-N. The full InChI is InChI=1S/C11H18FNO2/c1-7-3-4-8(9(7)12)15-10(14)13-11(2)5-6-11/h7-9H,3-6H2,1-2H3,(H,13,14)/t7-,8+,9+/m0/s1.
What are the key properties of [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate?
[(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate has a molecular weight of 215.27 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(1R,2R,3S)-2-fluoro-3-methylcyclopentyl] N-(1-methylcyclopropyl)carbamate is sourced from PubChem (CID 170110763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).