C23H26ClFN6O — CID 170111209
3-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-(2-chloro-3-fluorophenyl)ethyl]-8-methylpyrido[2,3-d]pyridazin-5-amine (PubChem CID 170111209) has the molecular formula C23H26ClFN6O and a molecular weight of 456.95 g/mol. Its IUPAC name is 3-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-(2-chloro-3-fluorophenyl)ethyl]-8-methylpyrido[2,3-d]pyridazin-5-amine.
| Compound Name | 3-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-(2-chloro-3-fluorophenyl)ethyl]-8-methylpyrido[2,3-d]pyridazin-5-amine |
|---|---|
| PubChem CID | 170111209 |
| Molecular Formula | C23H26ClFN6O |
| Molecular Weight | 456.95 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | 3-[(9aS)-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazin-8-yl]-N-[(1R)-1-(2-chloro-3-fluorophenyl)ethyl]-8-methylpyrido[2,3-d]pyridazin-5-amine |
| SMILES | Cc1nnc(N[C@H](C)c2cccc(F)c2Cl)c2cc(N3CCN4CCOC[C@@H]4C3)cnc12 |
| InChI | InChI=1S/C23H26ClFN6O/c1-14(18-4-3-5-20(25)21(18)24)27-23-19-10-16(11-26-22(19)15(2)28-29-23)31-7-6-30-8-9-32-13-17(30)12-31/h3-5,10-11,14,17H,6-9,12-13H2,1-2H3,(H,27,29)/t14-,17+/m1/s1 |
| InChIKey | MSALYCODBZJCGG-PBHICJAKSA-N |
| XLogP | 3.82 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.95 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |