C12H18FNO2 — CID 170111593
[(1R,2R,3R)-3-ethenyl-2-fluorocyclopentyl] N-(1-methylcyclopropyl)carbamate (PubChem CID 170111593) has the molecular formula C12H18FNO2 and a molecular weight of 227.28 g/mol. Its IUPAC name is [(1R,2R,3R)-3-ethenyl-2-fluorocyclopentyl] N-(1-methylcyclopropyl)carbamate.
| Compound Name | [(1R,2R,3R)-3-ethenyl-2-fluorocyclopentyl] N-(1-methylcyclopropyl)carbamate |
|---|---|
| PubChem CID | 170111593 |
| Molecular Formula | C12H18FNO2 |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | [(1R,2R,3R)-3-ethenyl-2-fluorocyclopentyl] N-(1-methylcyclopropyl)carbamate |
| SMILES | C=C[C@H]1CC[C@@H](OC(=O)NC2(C)CC2)[C@@H]1F |
| InChI | InChI=1S/C12H18FNO2/c1-3-8-4-5-9(10(8)13)16-11(15)14-12(2)6-7-12/h3,8-10H,1,4-7H2,2H3,(H,14,15)/t8-,9+,10+/m0/s1 |
| InChIKey | SDAZWIGSANIVKZ-IVZWLZJFSA-N |
| XLogP | 2.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|