About [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate
[(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate (PubChem CID 170113031) has the molecular formula C10H16FNO3
and a molecular weight of 217.24 g/mol. Its IUPAC name is [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate.
Molecular Properties
| Compound Name | [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate |
| PubChem CID | 170113031 |
| Molecular Formula | C10H16FNO3 |
| Molecular Weight | 217.24 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate |
| SMILES | C[C@H]1OC[C@@H](OC(=O)NC2(C)CC2)[C@@H]1F |
| InChI | InChI=1S/C10H16FNO3/c1-6-8(11)7(5-14-6)15-9(13)12-10(2)3-4-10/h6-8H,3-5H2,1-2H3,(H,12,13)/t6-,7-,8-/m1/s1 |
| InChIKey | RXVFCQAUMHYUKB-BWZBUEFSSA-N |
| XLogP | 1.39 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.24 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate?
The IUPAC name of [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate (CID 170113031) is [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate.
What is the SMILES notation for [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate?
The canonical SMILES for [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate is C[C@H]1OC[C@@H](OC(=O)NC2(C)CC2)[C@@H]1F.
What is the InChIKey of [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate?
The InChIKey is RXVFCQAUMHYUKB-BWZBUEFSSA-N. The full InChI is InChI=1S/C10H16FNO3/c1-6-8(11)7(5-14-6)15-9(13)12-10(2)3-4-10/h6-8H,3-5H2,1-2H3,(H,12,13)/t6-,7-,8-/m1/s1.
What are the key properties of [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate?
[(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate has a molecular weight of 217.24 g/mol, XLogP of 1.39, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4R,5R)-4-fluoro-5-methyloxolan-3-yl] N-(1-methylcyclopropyl)carbamate is sourced from PubChem (CID 170113031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).