C25H30F3N5O3 — CID 170114740
2-[3-[(1R)-1-[[3-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-2,8-dimethylpyrido[2,3-d]pyridazin-5-yl]amino]ethyl]-2-fluorophenyl]-2,2-difluoroethanol (PubChem CID 170114740) has the molecular formula C25H30F3N5O3 and a molecular weight of 505.54 g/mol. Its IUPAC name is 2-[3-[(1R)-1-[[3-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-2,8-dimethylpyrido[2,3-d]pyridazin-5-yl]amino]ethyl]-2-fluorophenyl]-2,2-difluoroethanol.
| Compound Name | 2-[3-[(1R)-1-[[3-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-2,8-dimethylpyrido[2,3-d]pyridazin-5-yl]amino]ethyl]-2-fluorophenyl]-2,2-difluoroethanol |
|---|---|
| PubChem CID | 170114740 |
| Molecular Formula | C25H30F3N5O3 |
| Molecular Weight | 505.54 g/mol |
| Exact Mass | 505.23 |
| IUPAC Name | 2-[3-[(1R)-1-[[3-[(3R,4S)-3,4-dimethoxypyrrolidin-1-yl]-2,8-dimethylpyrido[2,3-d]pyridazin-5-yl]amino]ethyl]-2-fluorophenyl]-2,2-difluoroethanol |
| SMILES | CO[C@H]1CN(c2cc3c(N[C@H](C)c4cccc(C(F)(F)CO)c4F)nnc(C)c3nc2C)C[C@H]1OC |
| InChI | InChI=1S/C25H30F3N5O3/c1-13(16-7-6-8-18(22(16)26)25(27,28)12-34)30-24-17-9-19(14(2)29-23(17)15(3)31-32-24)33-10-20(35-4)21(11-33)36-5/h6-9,13,20-21,34H,10-12H2,1-5H3,(H,30,32)/t13-,20-,21+/m1/s1 |
| InChIKey | FVLXTJCMRLAOLB-PZVFOTJXSA-N |
| XLogP | 3.89 |
| TPSA | 92.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.54 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |