About (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate
(3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate (PubChem CID 170114839) has the molecular formula C19H34O6S2
and a molecular weight of 422.61 g/mol. Its IUPAC name is (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate.
Molecular Properties
| Compound Name | (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate |
| PubChem CID | 170114839 |
| Molecular Formula | C19H34O6S2 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate |
| SMILES | COS(=O)(=O)C1CCC(COC(=O)CSC(=O)C(CC(C)(C)C)C(C)C)C1 |
| InChI | InChI=1S/C19H34O6S2/c1-13(2)16(10-19(3,4)5)18(21)26-12-17(20)25-11-14-7-8-15(9-14)27(22,23)24-6/h13-16H,7-12H2,1-6H3 |
| InChIKey | FUPVHXNPVPCZOB-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate?
The IUPAC name of (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate (CID 170114839) is (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate.
What is the SMILES notation for (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate?
The canonical SMILES for (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate is COS(=O)(=O)C1CCC(COC(=O)CSC(=O)C(CC(C)(C)C)C(C)C)C1.
What is the InChIKey of (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate?
The InChIKey is FUPVHXNPVPCZOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34O6S2/c1-13(2)16(10-19(3,4)5)18(21)26-12-17(20)25-11-14-7-8-15(9-14)27(22,23)24-6/h13-16H,7-12H2,1-6H3.
What are the key properties of (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate?
(3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate has a molecular weight of 422.61 g/mol, XLogP of 3.64, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methoxysulfonylcyclopentyl)methyl 2-(4,4-dimethyl-2-propan-2-ylpentanoyl)sulfanylacetate is sourced from PubChem (CID 170114839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).