About 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole
4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole (PubChem CID 170114876) has the molecular formula C10H10F2N2
and a molecular weight of 196.20 g/mol. Its IUPAC name is 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole.
Molecular Properties
| Compound Name | 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole |
| PubChem CID | 170114876 |
| Molecular Formula | C10H10F2N2 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole |
| SMILES | CC1C=C(F)C(c2cn[nH]c2)=C[C@H]1F |
| InChI | InChI=1S/C10H10F2N2/c1-6-2-10(12)8(3-9(6)11)7-4-13-14-5-7/h2-6,9H,1H3,(H,13,14)/t6?,9-/m1/s1 |
| InChIKey | BMQGHVOEZISPEX-IOJJLOCKSA-N |
| XLogP | 2.63 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole?
The IUPAC name of 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole (CID 170114876) is 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole.
What is the SMILES notation for 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole?
The canonical SMILES for 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole is CC1C=C(F)C(c2cn[nH]c2)=C[C@H]1F.
What is the InChIKey of 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole?
The InChIKey is BMQGHVOEZISPEX-IOJJLOCKSA-N. The full InChI is InChI=1S/C10H10F2N2/c1-6-2-10(12)8(3-9(6)11)7-4-13-14-5-7/h2-6,9H,1H3,(H,13,14)/t6?,9-/m1/s1.
What are the key properties of 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole?
4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole has a molecular weight of 196.20 g/mol, XLogP of 2.63, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(3S)-3,6-difluoro-4-methylcyclohexa-1,5-dien-1-yl]-1H-pyrazole is sourced from PubChem (CID 170114876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).