C19H24F3N7O2 — CID 170114954
5-(4-ethoxybutan-2-yl)-4-methyl-14-(trifluoromethyl)-8-oxa-2,5,6,12,13,17,18-heptazatetracyclo[10.5.2.03,7.015,19]nonadeca-1(17),3,6,13,15,18-hexaene (PubChem CID 170114954) has the molecular formula C19H24F3N7O2 and a molecular weight of 439.44 g/mol. Its IUPAC name is 5-(4-ethoxybutan-2-yl)-4-methyl-14-(trifluoromethyl)-8-oxa-2,5,6,12,13,17,18-heptazatetracyclo[10.5.2.03,7.015,19]nonadeca-1(17),3,6,13,15,18-hexaene.
| Compound Name | 5-(4-ethoxybutan-2-yl)-4-methyl-14-(trifluoromethyl)-8-oxa-2,5,6,12,13,17,18-heptazatetracyclo[10.5.2.03,7.015,19]nonadeca-1(17),3,6,13,15,18-hexaene |
|---|---|
| PubChem CID | 170114954 |
| Molecular Formula | C19H24F3N7O2 |
| Molecular Weight | 439.44 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 5-(4-ethoxybutan-2-yl)-4-methyl-14-(trifluoromethyl)-8-oxa-2,5,6,12,13,17,18-heptazatetracyclo[10.5.2.03,7.015,19]nonadeca-1(17),3,6,13,15,18-hexaene |
| SMILES | CCOCCC(C)n1nc2c(c1C)Nc1ncc3c(C(F)(F)F)nn(c3n1)CCCO2 |
| InChI | InChI=1S/C19H24F3N7O2/c1-4-30-9-6-11(2)29-12(3)14-17(27-29)31-8-5-7-28-16-13(10-23-18(24-14)25-16)15(26-28)19(20,21)22/h10-11H,4-9H2,1-3H3,(H,23,24,25) |
| InChIKey | XWAUCOZMFRCEII-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 91.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|