C17H24N4O2 — CID 170115828
4-amino-1-[(3Z,5E)-6-[2-(aminomethyl)oxolan-2-yl]-3-methylhepta-1,3,5-trien-2-yl]pyrimidin-2-one (PubChem CID 170115828) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 4-amino-1-[(3Z,5E)-6-[2-(aminomethyl)oxolan-2-yl]-3-methylhepta-1,3,5-trien-2-yl]pyrimidin-2-one.
| Compound Name | 4-amino-1-[(3Z,5E)-6-[2-(aminomethyl)oxolan-2-yl]-3-methylhepta-1,3,5-trien-2-yl]pyrimidin-2-one |
|---|---|
| PubChem CID | 170115828 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 4-amino-1-[(3Z,5E)-6-[2-(aminomethyl)oxolan-2-yl]-3-methylhepta-1,3,5-trien-2-yl]pyrimidin-2-one |
| SMILES | C=C(/C(C)=C\C=C(/C)C1(CN)CCCO1)n1ccc(N)nc1=O |
| InChI | InChI=1S/C17H24N4O2/c1-12(14(3)21-9-7-15(19)20-16(21)22)5-6-13(2)17(11-18)8-4-10-23-17/h5-7,9H,3-4,8,10-11,18H2,1-2H3,(H2,19,20,22)/b12-5-,13-6+ |
| InChIKey | ZWJHJIFOMYVUIK-UWRPRBHNSA-N |
| XLogP | 1.70 |
| TPSA | 96.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|