About 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide
7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide (PubChem CID 170116350) has the molecular formula C7H12INO2S
and a molecular weight of 301.15 g/mol. Its IUPAC name is 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide.
Molecular Properties
| Compound Name | 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide |
| PubChem CID | 170116350 |
| Molecular Formula | C7H12INO2S |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide |
| SMILES | O=S1(=O)CC2(CCN(I)CC2)C1 |
| InChI | InChI=1S/C7H12INO2S/c8-9-3-1-7(2-4-9)5-12(10,11)6-7/h1-6H2 |
| InChIKey | XOWAXSDPVPOBNS-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide?
The IUPAC name of 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide (CID 170116350) is 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide.
What is the SMILES notation for 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide?
The canonical SMILES for 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide is O=S1(=O)CC2(CCN(I)CC2)C1.
What is the InChIKey of 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide?
The InChIKey is XOWAXSDPVPOBNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12INO2S/c8-9-3-1-7(2-4-9)5-12(10,11)6-7/h1-6H2.
What are the key properties of 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide?
7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide has a molecular weight of 301.15 g/mol, XLogP of 0.85, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-2λ6-thia-7-azaspiro[3.5]nonane 2,2-dioxide is sourced from PubChem (CID 170116350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).