C29H35FN6 — CID 170116461
4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-fluoro-6-naphthalen-1-yl-1,3,7-triazecin-2-yl]-N,N-dimethylbutan-1-amine (PubChem CID 170116461) has the molecular formula C29H35FN6 and a molecular weight of 486.64 g/mol. Its IUPAC name is 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-fluoro-6-naphthalen-1-yl-1,3,7-triazecin-2-yl]-N,N-dimethylbutan-1-amine.
| Compound Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-fluoro-6-naphthalen-1-yl-1,3,7-triazecin-2-yl]-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 170116461 |
| Molecular Formula | C29H35FN6 |
| Molecular Weight | 486.64 g/mol |
| Exact Mass | 486.29 |
| IUPAC Name | 4-[4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-5-fluoro-6-naphthalen-1-yl-1,3,7-triazecin-2-yl]-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCc1ncccnc(-c2cccc3ccccc23)c(F)c(N2CC3CCC(C2)N3)n1 |
| InChI | InChI=1S/C29H35FN6/c1-35(2)18-6-5-13-26-31-16-8-17-32-28(25-12-7-10-21-9-3-4-11-24(21)25)27(30)29(34-26)36-19-22-14-15-23(20-36)33-22/h3-4,7-12,16-17,22-23,33H,5-6,13-15,18-20H2,1-2H3/b16-8-,17-8+,28-27+,29-27-,31-16-,31-26-,32-17+,32-28-,34-26+,34-29- |
| InChIKey | GVSNHRZSZUZZGC-LARFQBETSA-N |
| XLogP | 4.78 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|