C23H34FN3O6S — CID 170116672
3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methoxy]-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]propane-1-sulfonamide (PubChem CID 170116672) has the molecular formula C23H34FN3O6S and a molecular weight of 499.61 g/mol. Its IUPAC name is 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methoxy]-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]propane-1-sulfonamide.
| Compound Name | 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methoxy]-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 170116672 |
| Molecular Formula | C23H34FN3O6S |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.22 |
| IUPAC Name | 3-[(5,5-dimethyl-2,4-dioxoimidazolidin-1-yl)methoxy]-N-[1-[3-(2,2-dimethylpropoxy)-4-fluorophenyl]cyclopropyl]propane-1-sulfonamide |
| SMILES | CC(C)(C)COc1cc(C2(NS(=O)(=O)CCCOCN3C(=O)NC(=O)C3(C)C)CC2)ccc1F |
| InChI | InChI=1S/C23H34FN3O6S/c1-21(2,3)14-33-18-13-16(7-8-17(18)24)23(9-10-23)26-34(30,31)12-6-11-32-15-27-20(29)25-19(28)22(27,4)5/h7-8,13,26H,6,9-12,14-15H2,1-5H3,(H,25,28,29) |
| InChIKey | NYNGHPPTPMHVHN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|