C44H45N7O4 — CID 170116808
7-hydroxy-8-[[1-[10-(13-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl)decyl]triazol-4-yl]methoxy]-2-phenylchromen-4-one (PubChem CID 170116808) has the molecular formula C44H45N7O4 and a molecular weight of 735.89 g/mol. Its IUPAC name is 7-hydroxy-8-[[1-[10-(13-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl)decyl]triazol-4-yl]methoxy]-2-phenylchromen-4-one.
| Compound Name | 7-hydroxy-8-[[1-[10-(13-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl)decyl]triazol-4-yl]methoxy]-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 170116808 |
| Molecular Formula | C44H45N7O4 |
| Molecular Weight | 735.89 g/mol |
| Exact Mass | 735.35 |
| IUPAC Name | 7-hydroxy-8-[[1-[10-(13-methyl-3,4,5,13-tetrazatetracyclo[13.4.0.02,6.07,12]nonadeca-1(19),2(6),4,7,9,11,15,17-octaen-3-yl)decyl]triazol-4-yl]methoxy]-2-phenylchromen-4-one |
| SMILES | CN1Cc2ccccc2-c2c(nnn2CCCCCCCCCCn2cc(COc3c(O)ccc4c(=O)cc(-c5ccccc5)oc34)nn2)-c2ccccc21 |
| InChI | InChI=1S/C44H45N7O4/c1-49-28-32-19-11-12-20-34(32)42-41(35-21-13-14-22-37(35)49)46-48-51(42)26-16-7-5-3-2-4-6-15-25-50-29-33(45-47-50)30-54-44-38(52)24-23-36-39(53)27-40(55-43(36)44)31-17-9-8-10-18-31/h8-14,17-24,27,29,52H,2-7,15-16,25-26,28,30H2,1H3 |
| InChIKey | IUKFZUXMEPMQFJ-UHFFFAOYSA-N |
| XLogP | 9.03 |
| TPSA | 124.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 55 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.89 |
| LogP ≤ 5 | 9.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|