C15H25NO2 — CID 170117047
1-[(2E,4E)-5-ethoxy-6-methylhepta-2,4-dien-3-yl]-2-oxa-5-azabicyclo[2.2.1]heptane (PubChem CID 170117047) has the molecular formula C15H25NO2 and a molecular weight of 251.37 g/mol. Its IUPAC name is 1-[(2E,4E)-5-ethoxy-6-methylhepta-2,4-dien-3-yl]-2-oxa-5-azabicyclo[2.2.1]heptane.
| Compound Name | 1-[(2E,4E)-5-ethoxy-6-methylhepta-2,4-dien-3-yl]-2-oxa-5-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 170117047 |
| Molecular Formula | C15H25NO2 |
| Molecular Weight | 251.37 g/mol |
| Exact Mass | 251.19 |
| IUPAC Name | 1-[(2E,4E)-5-ethoxy-6-methylhepta-2,4-dien-3-yl]-2-oxa-5-azabicyclo[2.2.1]heptane |
| SMILES | C/C=C(\C=C(\OCC)C(C)C)C12CNC(CO1)C2 |
| InChI | InChI=1S/C15H25NO2/c1-5-12(7-14(11(3)4)17-6-2)15-8-13(9-18-15)16-10-15/h5,7,11,13,16H,6,8-10H2,1-4H3/b12-5+,14-7+ |
| InChIKey | IVCLEINRVJJYHF-HDNZRFSASA-N |
| XLogP | 2.64 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|