About 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one
1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one (PubChem CID 170117100) has the molecular formula C9H15FN2O
and a molecular weight of 186.23 g/mol. Its IUPAC name is 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one |
| PubChem CID | 170117100 |
| Molecular Formula | C9H15FN2O |
| Molecular Weight | 186.23 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](N)[C@@H](F)C[C@@H]1C |
| InChI | InChI=1S/C9H15FN2O/c1-3-9(13)12-5-8(11)7(10)4-6(12)2/h3,6-8H,1,4-5,11H2,2H3/t6-,7-,8-/m0/s1 |
| InChIKey | LRBSJRMCLWCTIS-FXQIFTODSA-N |
| XLogP | 0.46 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.23 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one?
The IUPAC name of 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one (CID 170117100) is 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one.
What is the SMILES notation for 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one?
The canonical SMILES for 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one is C=CC(=O)N1C[C@H](N)[C@@H](F)C[C@@H]1C.
What is the InChIKey of 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one?
The InChIKey is LRBSJRMCLWCTIS-FXQIFTODSA-N. The full InChI is InChI=1S/C9H15FN2O/c1-3-9(13)12-5-8(11)7(10)4-6(12)2/h3,6-8H,1,4-5,11H2,2H3/t6-,7-,8-/m0/s1.
What are the key properties of 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one?
1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one has a molecular weight of 186.23 g/mol, XLogP of 0.46, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,4S,5S)-5-amino-4-fluoro-2-methylpiperidin-1-yl]prop-2-en-1-one is sourced from PubChem (CID 170117100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).