C20H22FN3O2S2 — CID 170118489
(3Z)-3-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(methylideneamino)-4-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)buta-1,3-diene-2-thiol (PubChem CID 170118489) has the molecular formula C20H22FN3O2S2 and a molecular weight of 419.55 g/mol. Its IUPAC name is (3Z)-3-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(methylideneamino)-4-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)buta-1,3-diene-2-thiol.
| Compound Name | (3Z)-3-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(methylideneamino)-4-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)buta-1,3-diene-2-thiol |
|---|---|
| PubChem CID | 170118489 |
| Molecular Formula | C20H22FN3O2S2 |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | (3Z)-3-[4-fluoro-2-(2-methoxyethoxy)phenyl]-4-(methylideneamino)-4-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)buta-1,3-diene-2-thiol |
| SMILES | C=N/C(=C(\C(=C)S)c1ccc(F)cc1OCCOC)c1nc2c(s1)CNCC2 |
| InChI | InChI=1S/C20H22FN3O2S2/c1-12(27)18(14-5-4-13(21)10-16(14)26-9-8-25-3)19(22-2)20-24-15-6-7-23-11-17(15)28-20/h4-5,10,23,27H,1-2,6-9,11H2,3H3/b19-18+ |
| InChIKey | FWCQITWDGAIRCM-VHEBQXMUSA-N |
| XLogP | 3.97 |
| TPSA | 55.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|