C26H34N8O2 — CID 170119468
4-N-[6-[3-methanimidoyl-4-(methylamino)phenyl]pyrimidin-4-yl]-5-methoxy-1-N-methyl-1-N-(2-morpholin-4-ylethyl)benzene-1,2,4-triamine (PubChem CID 170119468) has the molecular formula C26H34N8O2 and a molecular weight of 490.61 g/mol. Its IUPAC name is 4-N-[6-[3-methanimidoyl-4-(methylamino)phenyl]pyrimidin-4-yl]-5-methoxy-1-N-methyl-1-N-(2-morpholin-4-ylethyl)benzene-1,2,4-triamine.
| Compound Name | 4-N-[6-[3-methanimidoyl-4-(methylamino)phenyl]pyrimidin-4-yl]-5-methoxy-1-N-methyl-1-N-(2-morpholin-4-ylethyl)benzene-1,2,4-triamine |
|---|---|
| PubChem CID | 170119468 |
| Molecular Formula | C26H34N8O2 |
| Molecular Weight | 490.61 g/mol |
| Exact Mass | 490.28 |
| IUPAC Name | 4-N-[6-[3-methanimidoyl-4-(methylamino)phenyl]pyrimidin-4-yl]-5-methoxy-1-N-methyl-1-N-(2-morpholin-4-ylethyl)benzene-1,2,4-triamine |
| SMILES | [H]/N=C/c1cc(-c2cc(Nc3cc(N)c(N(C)CCN4CCOCC4)cc3OC)ncn2)ccc1NC |
| InChI | InChI=1S/C26H34N8O2/c1-29-21-5-4-18(12-19(21)16-27)22-14-26(31-17-30-22)32-23-13-20(28)24(15-25(23)35-3)33(2)6-7-34-8-10-36-11-9-34/h4-5,12-17,27,29H,6-11,28H2,1-3H3,(H,30,31,32)/b27-16+ |
| InChIKey | NMBOKEVBMXDCKZ-JVWAILMASA-N |
| XLogP | 3.29 |
| TPSA | 124.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|