C23H36O4 — CID 170119482
[(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,10,14-pentamethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate (PubChem CID 170119482) has the molecular formula C23H36O4 and a molecular weight of 376.54 g/mol. Its IUPAC name is [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,10,14-pentamethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate.
| Compound Name | [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,10,14-pentamethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate |
|---|---|
| PubChem CID | 170119482 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.26 |
| IUPAC Name | [(1S,2R,3S,4S,6R,7R)-4-ethenyl-3-hydroxy-2,4,7,10,14-pentamethyl-6-tricyclo[5.4.3.01,8]tetradec-8-enyl] 2-hydroxyacetate |
| SMILES | C=C[C@]1(C)C[C@@H](OC(=O)CO)[C@@]2(C)C3=CC(C)C[C@@]3(CCC2C)[C@@H](C)[C@@H]1O |
| InChI | InChI=1S/C23H36O4/c1-7-21(5)12-18(27-19(25)13-24)22(6)15(3)8-9-23(16(4)20(21)26)11-14(2)10-17(22)23/h7,10,14-16,18,20,24,26H,1,8-9,11-13H2,2-6H3/t14?,15?,16-,18+,20-,21+,22+,23-/m0/s1 |
| InChIKey | MQIZZPVZQYWTGK-VOTVLZBLSA-N |
| XLogP | 3.87 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|