About 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine
4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine (PubChem CID 170119577) has the molecular formula C18H30N4OS
and a molecular weight of 350.53 g/mol. Its IUPAC name is 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine.
Molecular Properties
| Compound Name | 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine |
| PubChem CID | 170119577 |
| Molecular Formula | C18H30N4OS |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.21 |
| IUPAC Name | 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine |
| SMILES | Cc1cc(SN2CCC3(CCC(N4CCOCC4)C3)CC2)n(C)n1 |
| InChI | InChI=1S/C18H30N4OS/c1-15-13-17(20(2)19-15)24-22-7-5-18(6-8-22)4-3-16(14-18)21-9-11-23-12-10-21/h13,16H,3-12,14H2,1-2H3 |
| InChIKey | GYBXYFBUIDHVTR-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine?
The IUPAC name of 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine (CID 170119577) is 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine.
What is the SMILES notation for 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine?
The canonical SMILES for 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine is Cc1cc(SN2CCC3(CCC(N4CCOCC4)C3)CC2)n(C)n1.
What is the InChIKey of 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine?
The InChIKey is GYBXYFBUIDHVTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30N4OS/c1-15-13-17(20(2)19-15)24-22-7-5-18(6-8-22)4-3-16(14-18)21-9-11-23-12-10-21/h13,16H,3-12,14H2,1-2H3.
What are the key properties of 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine?
4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine has a molecular weight of 350.53 g/mol, XLogP of 2.70, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[8-(2,5-dimethylpyrazol-3-yl)sulfanyl-8-azaspiro[4.5]decan-3-yl]morpholine is sourced from PubChem (CID 170119577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).