C28H35N3O3S — CID 170120110
(2S,4R)-1-[(2R,3E,4Z)-3-ethylidene-2-propan-2-ylhepta-4,6-dienoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide (PubChem CID 170120110) has the molecular formula C28H35N3O3S and a molecular weight of 493.67 g/mol. Its IUPAC name is (2S,4R)-1-[(2R,3E,4Z)-3-ethylidene-2-propan-2-ylhepta-4,6-dienoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2R,3E,4Z)-3-ethylidene-2-propan-2-ylhepta-4,6-dienoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 170120110 |
| Molecular Formula | C28H35N3O3S |
| Molecular Weight | 493.67 g/mol |
| Exact Mass | 493.24 |
| IUPAC Name | (2S,4R)-1-[(2R,3E,4Z)-3-ethylidene-2-propan-2-ylhepta-4,6-dienoyl]-4-hydroxy-N-[[4-(4-methyl-1,3-thiazol-5-yl)phenyl]methyl]pyrrolidine-2-carboxamide |
| SMILES | C=C/C=C\C(=C/C)[C@H](C(=O)N1C[C@H](O)C[C@H]1C(=O)NCc1ccc(-c2scnc2C)cc1)C(C)C |
| InChI | InChI=1S/C28H35N3O3S/c1-6-8-9-21(7-2)25(18(3)4)28(34)31-16-23(32)14-24(31)27(33)29-15-20-10-12-22(13-11-20)26-19(5)30-17-35-26/h6-13,17-18,23-25,32H,1,14-16H2,2-5H3,(H,29,33)/b9-8-,21-7+/t23-,24+,25-/m1/s1 |
| InChIKey | CIBVPBBAHUUNHP-BKTMUTMESA-N |
| XLogP | 4.66 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.67 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|