About 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone
1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone (PubChem CID 170120300) has the molecular formula C10H11NO
and a molecular weight of 161.20 g/mol. Its IUPAC name is 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone |
| PubChem CID | 170120300 |
| Molecular Formula | C10H11NO |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.08 |
| IUPAC Name | 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone |
| SMILES | [H]/N=C1\C=CC=C(C(C)=O)\C1=C\C |
| InChI | InChI=1S/C10H11NO/c1-3-8-9(7(2)12)5-4-6-10(8)11/h3-6,11H,1-2H3/b8-3-,11-10+ |
| InChIKey | USFFRXBYIQNPFP-VQWHTZHVSA-N |
| XLogP | 2.04 |
| TPSA | 40.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone?
The IUPAC name of 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone (CID 170120300) is 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone.
What is the SMILES notation for 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone?
The canonical SMILES for 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone is [H]/N=C1\C=CC=C(C(C)=O)\C1=C\C.
What is the InChIKey of 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone?
The InChIKey is USFFRXBYIQNPFP-VQWHTZHVSA-N. The full InChI is InChI=1S/C10H11NO/c1-3-8-9(7(2)12)5-4-6-10(8)11/h3-6,11H,1-2H3/b8-3-,11-10+.
What are the key properties of 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone?
1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone has a molecular weight of 161.20 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(6Z)-6-ethylidene-5-iminocyclohexa-1,3-dien-1-yl]ethanone is sourced from PubChem (CID 170120300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).