About methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate
methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate (PubChem CID 170120381) has the molecular formula C10H11NO2
and a molecular weight of 177.20 g/mol. Its IUPAC name is methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate |
| PubChem CID | 170120381 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate |
| SMILES | [H]/N=C1\C=CC=C(C(=O)OC)\C1=C\C |
| InChI | InChI=1S/C10H11NO2/c1-3-7-8(10(12)13-2)5-4-6-9(7)11/h3-6,11H,1-2H3/b7-3-,11-9+ |
| InChIKey | HDFGDPDMVBLURB-ZDYUSVQVSA-N |
| XLogP | 1.62 |
| TPSA | 50.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate?
The IUPAC name of methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate (CID 170120381) is methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate.
What is the SMILES notation for methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate?
The canonical SMILES for methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate is [H]/N=C1\C=CC=C(C(=O)OC)\C1=C\C.
What is the InChIKey of methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate?
The InChIKey is HDFGDPDMVBLURB-ZDYUSVQVSA-N. The full InChI is InChI=1S/C10H11NO2/c1-3-7-8(10(12)13-2)5-4-6-9(7)11/h3-6,11H,1-2H3/b7-3-,11-9+.
What are the key properties of methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate?
methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate has a molecular weight of 177.20 g/mol, XLogP of 1.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (6Z)-6-ethylidene-5-iminocyclohexa-1,3-diene-1-carboxylate is sourced from PubChem (CID 170120381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).