About 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine
1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine (PubChem CID 170120577) has the molecular formula C10H20N2
and a molecular weight of 168.28 g/mol. Its IUPAC name is 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine.
Molecular Properties
| Compound Name | 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine |
| PubChem CID | 170120577 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine |
| SMILES | C=C(/C=C\CC)N(C)N(C)CC |
| InChI | InChI=1S/C10H20N2/c1-6-8-9-10(3)12(5)11(4)7-2/h8-9H,3,6-7H2,1-2,4-5H3/b9-8- |
| InChIKey | YVBCSCCCIWOHNB-HJWRWDBZSA-N |
| XLogP | 2.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine?
The IUPAC name of 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine (CID 170120577) is 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine.
What is the SMILES notation for 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine?
The canonical SMILES for 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine is C=C(/C=C\CC)N(C)N(C)CC.
What is the InChIKey of 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine?
The InChIKey is YVBCSCCCIWOHNB-HJWRWDBZSA-N. The full InChI is InChI=1S/C10H20N2/c1-6-8-9-10(3)12(5)11(4)7-2/h8-9H,3,6-7H2,1-2,4-5H3/b9-8-.
What are the key properties of 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine?
1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine has a molecular weight of 168.28 g/mol, XLogP of 2.26, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-[(3Z)-hexa-1,3-dien-2-yl]-1,2-dimethylhydrazine is sourced from PubChem (CID 170120577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).