C24H43N4O6PS — CID 170122118
(3R,6S,9aS)-1-[2-[ethoxy(methyl)phosphoryl]acetyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-6-(2-methylsulfanylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione (PubChem CID 170122118) has the molecular formula C24H43N4O6PS and a molecular weight of 546.67 g/mol. Its IUPAC name is (3R,6S,9aS)-1-[2-[ethoxy(methyl)phosphoryl]acetyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-6-(2-methylsulfanylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione.
| Compound Name | (3R,6S,9aS)-1-[2-[ethoxy(methyl)phosphoryl]acetyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-6-(2-methylsulfanylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione |
|---|---|
| PubChem CID | 170122118 |
| Molecular Formula | C24H43N4O6PS |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.26 |
| IUPAC Name | (3R,6S,9aS)-1-[2-[ethoxy(methyl)phosphoryl]acetyl]-8-(1-methylpiperidin-4-yl)-3-(2-methylpropyl)-6-(2-methylsulfanylethyl)-9,9a-dihydro-6H-pyrazino[2,1-c][1,2,4]oxadiazine-4,7-dione |
| SMILES | CCOP(C)(=O)CC(=O)N1O[C@H](CC(C)C)C(=O)N2[C@@H]1CN(C1CCN(C)CC1)C(=O)[C@@H]2CCSC |
| InChI | InChI=1S/C24H43N4O6PS/c1-7-33-35(5,32)16-22(29)28-21-15-26(18-8-11-25(4)12-9-18)23(30)19(10-13-36-6)27(21)24(31)20(34-28)14-17(2)3/h17-21H,7-16H2,1-6H3/t19-,20+,21-,35?/m0/s1 |
| InChIKey | CBEJZFQWFHLPAQ-AVRANMLHSA-N |
| XLogP | 2.33 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|