C22H27ClN2O3 — CID 17012218
N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(4-ethylphenoxy)acetamide (PubChem CID 17012218) has the molecular formula C22H27ClN2O3 and a molecular weight of 402.92 g/mol. Its IUPAC name is N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(4-ethylphenoxy)acetamide.
| Compound Name | N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(4-ethylphenoxy)acetamide |
|---|---|
| PubChem CID | 17012218 |
| Molecular Formula | C22H27ClN2O3 |
| Molecular Weight | 402.92 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[2-(2-chlorophenyl)-2-morpholin-4-ylethyl]-2-(4-ethylphenoxy)acetamide |
| SMILES | CCc1ccc(OCC(=O)NCC(c2ccccc2Cl)N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H27ClN2O3/c1-2-17-7-9-18(10-8-17)28-16-22(26)24-15-21(25-11-13-27-14-12-25)19-5-3-4-6-20(19)23/h3-10,21H,2,11-16H2,1H3,(H,24,26) |
| InChIKey | IFGJJQPVJRQXKE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.92 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |