About N,2-diethyl-N,4,6-trimethylaniline
N,2-diethyl-N,4,6-trimethylaniline (PubChem CID 170122413) has the molecular formula C13H21N
and a molecular weight of 191.32 g/mol. Its IUPAC name is N,2-diethyl-N,4,6-trimethylaniline.
Molecular Properties
| Compound Name | N,2-diethyl-N,4,6-trimethylaniline |
| PubChem CID | 170122413 |
| Molecular Formula | C13H21N |
| Molecular Weight | 191.32 g/mol |
| Exact Mass | 191.17 |
| IUPAC Name | N,2-diethyl-N,4,6-trimethylaniline |
| SMILES | CCc1cc(C)cc(C)c1N(C)CC |
| InChI | InChI=1S/C13H21N/c1-6-12-9-10(3)8-11(4)13(12)14(5)7-2/h8-9H,6-7H2,1-5H3 |
| InChIKey | LIONGLWLQFDNOV-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,2-diethyl-N,4,6-trimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-diethyl-N,4,6-trimethylaniline?
The IUPAC name of N,2-diethyl-N,4,6-trimethylaniline (CID 170122413) is N,2-diethyl-N,4,6-trimethylaniline.
What is the SMILES notation for N,2-diethyl-N,4,6-trimethylaniline?
The canonical SMILES for N,2-diethyl-N,4,6-trimethylaniline is CCc1cc(C)cc(C)c1N(C)CC.
What is the InChIKey of N,2-diethyl-N,4,6-trimethylaniline?
The InChIKey is LIONGLWLQFDNOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H21N/c1-6-12-9-10(3)8-11(4)13(12)14(5)7-2/h8-9H,6-7H2,1-5H3.
What are the key properties of N,2-diethyl-N,4,6-trimethylaniline?
N,2-diethyl-N,4,6-trimethylaniline has a molecular weight of 191.32 g/mol, XLogP of 3.32, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-diethyl-N,4,6-trimethylaniline is sourced from PubChem (CID 170122413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).