C15H27N — CID 170122533
2,4,6-tri(propan-2-yl)cyclohexa-2,4-dien-1-amine (PubChem CID 170122533) has the molecular formula C15H27N and a molecular weight of 221.39 g/mol. Its IUPAC name is 2,4,6-tri(propan-2-yl)cyclohexa-2,4-dien-1-amine.
| Compound Name | 2,4,6-tri(propan-2-yl)cyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 170122533 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 2,4,6-tri(propan-2-yl)cyclohexa-2,4-dien-1-amine |
| SMILES | CC(C)C1=CC(C(C)C)C(N)C(C(C)C)=C1 |
| InChI | InChI=1S/C15H27N/c1-9(2)12-7-13(10(3)4)15(16)14(8-12)11(5)6/h7-11,13,15H,16H2,1-6H3 |
| InChIKey | WHOBMFRCJMJRGU-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |