C17H20O3 — CID 170122750
(2E,3E)-2,3-di(ethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methoxypyran-4-one (PubChem CID 170122750) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (2E,3E)-2,3-di(ethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methoxypyran-4-one.
| Compound Name | (2E,3E)-2,3-di(ethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methoxypyran-4-one |
|---|---|
| PubChem CID | 170122750 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (2E,3E)-2,3-di(ethylidene)-6-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methoxypyran-4-one |
| SMILES | C=C/C(=C\C=C/C)c1oc(=C/C)/c(=C\C)c(=O)c1OC |
| InChI | InChI=1S/C17H20O3/c1-6-10-11-12(7-2)16-17(19-5)15(18)13(8-3)14(9-4)20-16/h6-11H,2H2,1,3-5H3/b10-6-,12-11+,13-8+,14-9+ |
| InChIKey | FNECCGZCKKWIDQ-MIRZAVKYSA-N |
| XLogP | 2.39 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|