About 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate
2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate (PubChem CID 170122777) has the molecular formula C12H14N2O4
and a molecular weight of 250.25 g/mol. Its IUPAC name is 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate.
Molecular Properties
| Compound Name | 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate |
| PubChem CID | 170122777 |
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate |
| SMILES | Cc1cc(C)n(CCOC(=O)/C=C/C=O)c(=O)n1 |
| InChI | InChI=1S/C12H14N2O4/c1-9-8-10(2)14(12(17)13-9)5-7-18-11(16)4-3-6-15/h3-4,6,8H,5,7H2,1-2H3/b4-3+ |
| InChIKey | RMUJKWALXGJAMJ-ONEGZZNKSA-N |
| XLogP | 0.16 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.25 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate?
The IUPAC name of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate (CID 170122777) is 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate.
What is the SMILES notation for 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate?
The canonical SMILES for 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate is Cc1cc(C)n(CCOC(=O)/C=C/C=O)c(=O)n1.
What is the InChIKey of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate?
The InChIKey is RMUJKWALXGJAMJ-ONEGZZNKSA-N. The full InChI is InChI=1S/C12H14N2O4/c1-9-8-10(2)14(12(17)13-9)5-7-18-11(16)4-3-6-15/h3-4,6,8H,5,7H2,1-2H3/b4-3+.
What are the key properties of 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate?
2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate has a molecular weight of 250.25 g/mol, XLogP of 0.16, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4,6-dimethyl-2-oxopyrimidin-1-yl)ethyl (E)-4-oxobut-2-enoate is sourced from PubChem (CID 170122777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).