C28H31FNO2+ — CID 170122929
2-fluoro-7-[1-[(Z)-4-methoxypent-2-en-2-yl]oxyethenyl]-3,8,10-trimethyl-6,7-dihydroisoquinolino[2,1-a]quinolin-5-ium (PubChem CID 170122929) has the molecular formula C28H31FNO2+ and a molecular weight of 432.56 g/mol. Its IUPAC name is 2-fluoro-7-[1-[(Z)-4-methoxypent-2-en-2-yl]oxyethenyl]-3,8,10-trimethyl-6,7-dihydroisoquinolino[2,1-a]quinolin-5-ium.
| Compound Name | 2-fluoro-7-[1-[(Z)-4-methoxypent-2-en-2-yl]oxyethenyl]-3,8,10-trimethyl-6,7-dihydroisoquinolino[2,1-a]quinolin-5-ium |
|---|---|
| PubChem CID | 170122929 |
| Molecular Formula | C28H31FNO2+ |
| Molecular Weight | 432.56 g/mol |
| Exact Mass | 432.23 |
| IUPAC Name | 2-fluoro-7-[1-[(Z)-4-methoxypent-2-en-2-yl]oxyethenyl]-3,8,10-trimethyl-6,7-dihydroisoquinolino[2,1-a]quinolin-5-ium |
| SMILES | C=C(O/C(C)=C\C(C)OC)C1C[n+]2c(ccc3cc(F)c(C)cc32)-c2cc(C)cc(C)c21 |
| InChI | InChI=1S/C28H31FNO2/c1-16-10-18(3)28-23(11-16)26-9-8-22-14-25(29)17(2)12-27(22)30(26)15-24(28)21(6)32-20(5)13-19(4)31-7/h8-14,19,24H,6,15H2,1-5,7H3/q+1/b20-13- |
| InChIKey | QOMDBBYYAZNCBN-MOSHPQCFSA-N |
| XLogP | 6.42 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|