C13H27N3O3 — CID 170122942
(2S)-2-amino-N-(2,2-diethoxyethyl)-N-[(3R)-pyrrolidin-3-yl]propanamide (PubChem CID 170122942) has the molecular formula C13H27N3O3 and a molecular weight of 273.38 g/mol. Its IUPAC name is (2S)-2-amino-N-(2,2-diethoxyethyl)-N-[(3R)-pyrrolidin-3-yl]propanamide.
| Compound Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-N-[(3R)-pyrrolidin-3-yl]propanamide |
|---|---|
| PubChem CID | 170122942 |
| Molecular Formula | C13H27N3O3 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | (2S)-2-amino-N-(2,2-diethoxyethyl)-N-[(3R)-pyrrolidin-3-yl]propanamide |
| SMILES | CCOC(CN(C(=O)[C@H](C)N)[C@@H]1CCNC1)OCC |
| InChI | InChI=1S/C13H27N3O3/c1-4-18-12(19-5-2)9-16(13(17)10(3)14)11-6-7-15-8-11/h10-12,15H,4-9,14H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | VWRMZOHAOWWZAG-WDEREUQCSA-N |
| XLogP | -0.08 |
| TPSA | 76.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|