C29H26F2N6O6 — CID 170123519
N-[4-[[2-amino-3-[3-[2-methoxyethoxy(methyl)amino]-3-oxoprop-1-ynyl]-4-pyridinyl]oxy]-3-fluorophenyl]-2-(4-fluorophenyl)-3-hydroxy-3H-pyridazine-4-carboxamide (PubChem CID 170123519) has the molecular formula C29H26F2N6O6 and a molecular weight of 592.56 g/mol. Its IUPAC name is N-[4-[[2-amino-3-[3-[2-methoxyethoxy(methyl)amino]-3-oxoprop-1-ynyl]-4-pyridinyl]oxy]-3-fluorophenyl]-2-(4-fluorophenyl)-3-hydroxy-3H-pyridazine-4-carboxamide.
| Compound Name | N-[4-[[2-amino-3-[3-[2-methoxyethoxy(methyl)amino]-3-oxoprop-1-ynyl]-4-pyridinyl]oxy]-3-fluorophenyl]-2-(4-fluorophenyl)-3-hydroxy-3H-pyridazine-4-carboxamide |
|---|---|
| PubChem CID | 170123519 |
| Molecular Formula | C29H26F2N6O6 |
| Molecular Weight | 592.56 g/mol |
| Exact Mass | 592.19 |
| IUPAC Name | N-[4-[[2-amino-3-[3-[2-methoxyethoxy(methyl)amino]-3-oxoprop-1-ynyl]-4-pyridinyl]oxy]-3-fluorophenyl]-2-(4-fluorophenyl)-3-hydroxy-3H-pyridazine-4-carboxamide |
| SMILES | COCCON(C)C(=O)C#Cc1c(Oc2ccc(NC(=O)C3=CC=NN(c4ccc(F)cc4)C3O)cc2F)ccnc1N |
| InChI | InChI=1S/C29H26F2N6O6/c1-36(42-16-15-41-2)26(38)10-8-21-24(12-13-33-27(21)32)43-25-9-5-19(17-23(25)31)35-28(39)22-11-14-34-37(29(22)40)20-6-3-18(30)4-7-20/h3-7,9,11-14,17,29,40H,15-16H2,1-2H3,(H2,32,33)(H,35,39) |
| InChIKey | BZYZZSPTGATNPP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 151.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|