C23H25N2O3P — CID 170124233
4-[[ethoxy(methyl)phosphoryl]methyl]-N-(4-methyl-3-pyridin-2-ylphenyl)benzamide (PubChem CID 170124233) has the molecular formula C23H25N2O3P and a molecular weight of 408.44 g/mol. Its IUPAC name is 4-[[ethoxy(methyl)phosphoryl]methyl]-N-(4-methyl-3-pyridin-2-ylphenyl)benzamide.
| Compound Name | 4-[[ethoxy(methyl)phosphoryl]methyl]-N-(4-methyl-3-pyridin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 170124233 |
| Molecular Formula | C23H25N2O3P |
| Molecular Weight | 408.44 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | 4-[[ethoxy(methyl)phosphoryl]methyl]-N-(4-methyl-3-pyridin-2-ylphenyl)benzamide |
| SMILES | CCOP(C)(=O)Cc1ccc(C(=O)Nc2ccc(C)c(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C23H25N2O3P/c1-4-28-29(3,27)16-18-9-11-19(12-10-18)23(26)25-20-13-8-17(2)21(15-20)22-7-5-6-14-24-22/h5-15H,4,16H2,1-3H3,(H,25,26) |
| InChIKey | SXYRDUGTLGBWEN-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|