About 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one
4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one (PubChem CID 170125233) has the molecular formula C9H13BrN4O2
and a molecular weight of 289.13 g/mol. Its IUPAC name is 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one.
Molecular Properties
| Compound Name | 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one |
| PubChem CID | 170125233 |
| Molecular Formula | C9H13BrN4O2 |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one |
| SMILES | CN1CCN(C2=NC(Br)=CNC2O)CC1=O |
| InChI | InChI=1S/C9H13BrN4O2/c1-13-2-3-14(5-7(13)15)8-9(16)11-4-6(10)12-8/h4,9,11,16H,2-3,5H2,1H3 |
| InChIKey | CVFMUMGNLGYUTB-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one?
The IUPAC name of 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one (CID 170125233) is 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one.
What is the SMILES notation for 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one?
The canonical SMILES for 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one is CN1CCN(C2=NC(Br)=CNC2O)CC1=O.
What is the InChIKey of 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one?
The InChIKey is CVFMUMGNLGYUTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13BrN4O2/c1-13-2-3-14(5-7(13)15)8-9(16)11-4-6(10)12-8/h4,9,11,16H,2-3,5H2,1H3.
What are the key properties of 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one?
4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one has a molecular weight of 289.13 g/mol, XLogP of -0.73, 0 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-bromo-2-hydroxy-1,2-dihydropyrazin-3-yl)-1-methylpiperazin-2-one is sourced from PubChem (CID 170125233), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).