About 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione
1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione (PubChem CID 170125581) has the molecular formula C24H36N2S2
and a molecular weight of 416.70 g/mol. Its IUPAC name is 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione.
Molecular Properties
| Compound Name | 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione |
| PubChem CID | 170125581 |
| Molecular Formula | C24H36N2S2 |
| Molecular Weight | 416.70 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione |
| SMILES | CC(C)CC(CCCCCCn1ccc(=S)[nH]c1=S)(c1ccccc1)C(C)C |
| InChI | InChI=1S/C24H36N2S2/c1-19(2)18-24(20(3)4,21-12-8-7-9-13-21)15-10-5-6-11-16-26-17-14-22(27)25-23(26)28/h7-9,12-14,17,19-20H,5-6,10-11,15-16,18H2,1-4H3,(H,25,27,28) |
| InChIKey | KKAXKGUZZLSZMA-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 20.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.70 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione?
The IUPAC name of 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione (CID 170125581) is 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione.
What is the SMILES notation for 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione?
The canonical SMILES for 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione is CC(C)CC(CCCCCCn1ccc(=S)[nH]c1=S)(c1ccccc1)C(C)C.
What is the InChIKey of 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione?
The InChIKey is KKAXKGUZZLSZMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H36N2S2/c1-19(2)18-24(20(3)4,21-12-8-7-9-13-21)15-10-5-6-11-16-26-17-14-22(27)25-23(26)28/h7-9,12-14,17,19-20H,5-6,10-11,15-16,18H2,1-4H3,(H,25,27,28).
What are the key properties of 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione?
1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione has a molecular weight of 416.70 g/mol, XLogP of 7.87, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)pyrimidine-2,4-dithione is sourced from PubChem (CID 170125581), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).