C18H21FN4O2S — CID 170125715
5-fluoro-2-[formyl-(4-methyl-2-propylsulfanyl-3-pyridinyl)amino]-N,6-dimethylpyridine-3-carboxamide (PubChem CID 170125715) has the molecular formula C18H21FN4O2S and a molecular weight of 376.46 g/mol. Its IUPAC name is 5-fluoro-2-[formyl-(4-methyl-2-propylsulfanyl-3-pyridinyl)amino]-N,6-dimethylpyridine-3-carboxamide.
| Compound Name | 5-fluoro-2-[formyl-(4-methyl-2-propylsulfanyl-3-pyridinyl)amino]-N,6-dimethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 170125715 |
| Molecular Formula | C18H21FN4O2S |
| Molecular Weight | 376.46 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | 5-fluoro-2-[formyl-(4-methyl-2-propylsulfanyl-3-pyridinyl)amino]-N,6-dimethylpyridine-3-carboxamide |
| SMILES | CCCSc1nccc(C)c1N(C=O)c1nc(C)c(F)cc1C(=O)NC |
| InChI | InChI=1S/C18H21FN4O2S/c1-5-8-26-18-15(11(2)6-7-21-18)23(10-24)16-13(17(25)20-4)9-14(19)12(3)22-16/h6-7,9-10H,5,8H2,1-4H3,(H,20,25) |
| InChIKey | WDNYWFHQYDIPIV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.46 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|