C27H40N2O5 — CID 170125745
6-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]hexyl 2,4-dimethyl-2-propan-2-ylpentanoate (PubChem CID 170125745) has the molecular formula C27H40N2O5 and a molecular weight of 472.63 g/mol. Its IUPAC name is 6-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]hexyl 2,4-dimethyl-2-propan-2-ylpentanoate.
| Compound Name | 6-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]hexyl 2,4-dimethyl-2-propan-2-ylpentanoate |
|---|---|
| PubChem CID | 170125745 |
| Molecular Formula | C27H40N2O5 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.29 |
| IUPAC Name | 6-[5-(4-methoxyphenyl)-2,4-dioxopyrimidin-1-yl]hexyl 2,4-dimethyl-2-propan-2-ylpentanoate |
| SMILES | COc1ccc(-c2cn(CCCCCCOC(=O)C(C)(CC(C)C)C(C)C)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C27H40N2O5/c1-19(2)17-27(5,20(3)4)25(31)34-16-10-8-7-9-15-29-18-23(24(30)28-26(29)32)21-11-13-22(33-6)14-12-21/h11-14,18-20H,7-10,15-17H2,1-6H3,(H,28,30,32) |
| InChIKey | ZROZVVWZBARFEE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|