C24H31FN4O4 — CID 170126241
[[1-tert-butyl-3-[(1R,3R,4S)-3-fluoro-4-[(1-methylcyclopropyl)carbamoyloxy]cyclopentyl]pyrazol-5-yl]amino] benzoate (PubChem CID 170126241) has the molecular formula C24H31FN4O4 and a molecular weight of 458.53 g/mol. Its IUPAC name is [[1-tert-butyl-3-[(1R,3R,4S)-3-fluoro-4-[(1-methylcyclopropyl)carbamoyloxy]cyclopentyl]pyrazol-5-yl]amino] benzoate.
| Compound Name | [[1-tert-butyl-3-[(1R,3R,4S)-3-fluoro-4-[(1-methylcyclopropyl)carbamoyloxy]cyclopentyl]pyrazol-5-yl]amino] benzoate |
|---|---|
| PubChem CID | 170126241 |
| Molecular Formula | C24H31FN4O4 |
| Molecular Weight | 458.53 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [[1-tert-butyl-3-[(1R,3R,4S)-3-fluoro-4-[(1-methylcyclopropyl)carbamoyloxy]cyclopentyl]pyrazol-5-yl]amino] benzoate |
| SMILES | CC1(NC(=O)O[C@H]2C[C@@H](c3cc(NOC(=O)c4ccccc4)n(C(C)(C)C)n3)C[C@H]2F)CC1 |
| InChI | InChI=1S/C24H31FN4O4/c1-23(2,3)29-20(28-33-21(30)15-8-6-5-7-9-15)14-18(27-29)16-12-17(25)19(13-16)32-22(31)26-24(4)10-11-24/h5-9,14,16-17,19,28H,10-13H2,1-4H3,(H,26,31)/t16-,17+,19-/m0/s1 |
| InChIKey | JVIWRMTXKUSSPA-SCTDSRPQSA-N |
| XLogP | 4.68 |
| TPSA | 94.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.53 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|