C41H47F3O3P2 — CID 170127074
4,8-ditert-butyl-6-[(2S)-3-[(2R,5R)-2,5-diphenylphospholan-1-yl]-1,1,1-trifluoropropan-2-yl]oxy-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepine (PubChem CID 170127074) has the molecular formula C41H47F3O3P2 and a molecular weight of 706.77 g/mol. Its IUPAC name is 4,8-ditert-butyl-6-[(2S)-3-[(2R,5R)-2,5-diphenylphospholan-1-yl]-1,1,1-trifluoropropan-2-yl]oxy-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepine.
| Compound Name | 4,8-ditert-butyl-6-[(2S)-3-[(2R,5R)-2,5-diphenylphospholan-1-yl]-1,1,1-trifluoropropan-2-yl]oxy-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepine |
|---|---|
| PubChem CID | 170127074 |
| Molecular Formula | C41H47F3O3P2 |
| Molecular Weight | 706.77 g/mol |
| Exact Mass | 706.30 |
| IUPAC Name | 4,8-ditert-butyl-6-[(2S)-3-[(2R,5R)-2,5-diphenylphospholan-1-yl]-1,1,1-trifluoropropan-2-yl]oxy-2,10-dimethylbenzo[d][1,3,2]benzodioxaphosphepine |
| SMILES | Cc1cc(C(C)(C)C)c2op(O[C@H](CP3[C@@H](c4ccccc4)CC[C@@H]3c3ccccc3)C(F)(F)F)oc3c(C(C)(C)C)cc(C)cc3c2c1 |
| InChI | InChI=1S/C41H47F3O3P2/c1-26-21-30-31-22-27(2)24-33(40(6,7)8)38(31)47-49(46-37(30)32(23-26)39(3,4)5)45-36(41(42,43)44)25-48-34(28-15-11-9-12-16-28)19-20-35(48)29-17-13-10-14-18-29/h9-18,21-24,34-36H,19-20,25H2,1-8H3/t34-,35-,36-/m1/s1 |
| InChIKey | OKEVYZVTLHCGGC-KUFDTJSHSA-N |
| XLogP | 13.62 |
| TPSA | 35.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.77 |
| LogP ≤ 5 | 13.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|