C43H81NO — CID 170127626
(Z)-1-(dimethylamino)-6-[(9Z,11E)-heptadeca-9,11-dienyl]tetracos-15-en-5-one (PubChem CID 170127626) has the molecular formula C43H81NO and a molecular weight of 628.13 g/mol. Its IUPAC name is (Z)-1-(dimethylamino)-6-[(9Z,11E)-heptadeca-9,11-dienyl]tetracos-15-en-5-one.
| Compound Name | (Z)-1-(dimethylamino)-6-[(9Z,11E)-heptadeca-9,11-dienyl]tetracos-15-en-5-one |
|---|---|
| PubChem CID | 170127626 |
| Molecular Formula | C43H81NO |
| Molecular Weight | 628.13 g/mol |
| Exact Mass | 627.63 |
| IUPAC Name | (Z)-1-(dimethylamino)-6-[(9Z,11E)-heptadeca-9,11-dienyl]tetracos-15-en-5-one |
| SMILES | CCCCC/C=C/C=C\CCCCCCCCC(CCCCCCCC/C=C\CCCCCCCC)C(=O)CCCCN(C)C |
| InChI | InChI=1S/C43H81NO/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-39-42(43(45)40-36-37-41-44(3)4)38-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h14,16,18-21,42H,5-13,15,17,22-41H2,1-4H3/b16-14+,20-18-,21-19- |
| InChIKey | DJGVZNYDCYTCEB-IYDSANMQSA-N |
| XLogP | 14.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.13 |
| LogP ≤ 5 | 14.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|