C16H31N3O2S — CID 170127748
2-[2-[4-(4-methylpentyl)piperidin-1-yl]-2-oxoethyl]sulfanylpropanehydrazide (PubChem CID 170127748) has the molecular formula C16H31N3O2S and a molecular weight of 329.51 g/mol. Its IUPAC name is 2-[2-[4-(4-methylpentyl)piperidin-1-yl]-2-oxoethyl]sulfanylpropanehydrazide.
| Compound Name | 2-[2-[4-(4-methylpentyl)piperidin-1-yl]-2-oxoethyl]sulfanylpropanehydrazide |
|---|---|
| PubChem CID | 170127748 |
| Molecular Formula | C16H31N3O2S |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 2-[2-[4-(4-methylpentyl)piperidin-1-yl]-2-oxoethyl]sulfanylpropanehydrazide |
| SMILES | CC(C)CCCC1CCN(C(=O)CSC(C)C(=O)NN)CC1 |
| InChI | InChI=1S/C16H31N3O2S/c1-12(2)5-4-6-14-7-9-19(10-8-14)15(20)11-22-13(3)16(21)18-17/h12-14H,4-11,17H2,1-3H3,(H,18,21) |
| InChIKey | ATTPJZQMRXPYQC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|