C29H54N2 — CID 170127956
(E)-4-ethyl-6-N,4,7-trimethyl-9-(2-methylcyclohex-3-en-1-yl)-3-N-[(E)-2,3,3-trimethylbut-1-enyl]dec-8-ene-3,6-diamine (PubChem CID 170127956) has the molecular formula C29H54N2 and a molecular weight of 430.77 g/mol. Its IUPAC name is (E)-4-ethyl-6-N,4,7-trimethyl-9-(2-methylcyclohex-3-en-1-yl)-3-N-[(E)-2,3,3-trimethylbut-1-enyl]dec-8-ene-3,6-diamine.
| Compound Name | (E)-4-ethyl-6-N,4,7-trimethyl-9-(2-methylcyclohex-3-en-1-yl)-3-N-[(E)-2,3,3-trimethylbut-1-enyl]dec-8-ene-3,6-diamine |
|---|---|
| PubChem CID | 170127956 |
| Molecular Formula | C29H54N2 |
| Molecular Weight | 430.77 g/mol |
| Exact Mass | 430.43 |
| IUPAC Name | (E)-4-ethyl-6-N,4,7-trimethyl-9-(2-methylcyclohex-3-en-1-yl)-3-N-[(E)-2,3,3-trimethylbut-1-enyl]dec-8-ene-3,6-diamine |
| SMILES | CCC(N/C=C(\C)C(C)(C)C)C(C)(CC)CC(NC)C(C)/C=C(\C)C1CCC=CC1C |
| InChI | InChI=1S/C29H54N2/c1-12-27(31-20-24(6)28(7,8)9)29(10,13-2)19-26(30-11)23(5)18-22(4)25-17-15-14-16-21(25)3/h14,16,18,20-21,23,25-27,30-31H,12-13,15,17,19H2,1-11H3/b22-18+,24-20+ |
| InChIKey | OGZLZFSZFLDMHZ-AXLVWYRQSA-N |
| XLogP | 7.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.77 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|